About octane-1,5-diimine
octane-1,5-diimine (PubChem CID 129214712) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is octane-1,5-diimine.
Molecular Properties
| Compound Name | octane-1,5-diimine |
| PubChem CID | 129214712 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | octane-1,5-diimine |
| SMILES | [H]/N=C/CCC/C(CCC)=N/[H] |
| InChI | InChI=1S/C8H16N2/c1-2-5-8(10)6-3-4-7-9/h7,9-10H,2-6H2,1H3/b9-7+,10-8+ |
| InChIKey | LYQAWQNYRWBDIZ-FIFLTTCUSA-N |
| XLogP | 2.63 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze octane-1,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-1,5-diimine?
The IUPAC name of octane-1,5-diimine (CID 129214712) is octane-1,5-diimine.
What is the SMILES notation for octane-1,5-diimine?
The canonical SMILES for octane-1,5-diimine is [H]/N=C/CCC/C(CCC)=N/[H].
What is the InChIKey of octane-1,5-diimine?
The InChIKey is LYQAWQNYRWBDIZ-FIFLTTCUSA-N. The full InChI is InChI=1S/C8H16N2/c1-2-5-8(10)6-3-4-7-9/h7,9-10H,2-6H2,1H3/b9-7+,10-8+.
What are the key properties of octane-1,5-diimine?
octane-1,5-diimine has a molecular weight of 140.23 g/mol, XLogP of 2.63, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octane-1,5-diimine is sourced from PubChem (CID 129214712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).