About hexan-1-imine;tetrabromoosmium
hexan-1-imine;tetrabromoosmium (PubChem CID 175766218) has the molecular formula C6H13Br4NOs
and a molecular weight of 609.02 g/mol. Its IUPAC name is hexan-1-imine;tetrabromoosmium.
Molecular Properties
| Compound Name | hexan-1-imine;tetrabromoosmium |
| PubChem CID | 175766218 |
| Molecular Formula | C6H13Br4NOs |
| Molecular Weight | 609.02 g/mol |
| Exact Mass | 606.74 |
| IUPAC Name | hexan-1-imine;tetrabromoosmium |
| SMILES | Br[Os](Br)(Br)Br.[H]/N=C/CCCCC |
| InChI | InChI=1S/C6H13N.4BrH.Os/c1-2-3-4-5-6-7;;;;;/h6-7H,2-5H2,1H3;4*1H;/q;;;;;+4/p-4/b7-6+;;;;; |
| InChIKey | LXZFAAKXVNAJIY-HEANBJSFSA-J |
| XLogP | 5.60 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 609.02 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze hexan-1-imine;tetrabromoosmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-1-imine;tetrabromoosmium?
The IUPAC name of hexan-1-imine;tetrabromoosmium (CID 175766218) is hexan-1-imine;tetrabromoosmium.
What is the SMILES notation for hexan-1-imine;tetrabromoosmium?
The canonical SMILES for hexan-1-imine;tetrabromoosmium is Br[Os](Br)(Br)Br.[H]/N=C/CCCCC.
What is the InChIKey of hexan-1-imine;tetrabromoosmium?
The InChIKey is LXZFAAKXVNAJIY-HEANBJSFSA-J. The full InChI is InChI=1S/C6H13N.4BrH.Os/c1-2-3-4-5-6-7;;;;;/h6-7H,2-5H2,1H3;4*1H;/q;;;;;+4/p-4/b7-6+;;;;;.
What are the key properties of hexan-1-imine;tetrabromoosmium?
hexan-1-imine;tetrabromoosmium has a molecular weight of 609.02 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-1-imine;tetrabromoosmium is sourced from PubChem (CID 175766218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).