C10H16 — CID 143688525
(3E,4E)-3-ethylidene-4-methylhepta-1,4-diene (PubChem CID 143688525) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (3E,4E)-3-ethylidene-4-methylhepta-1,4-diene.
| Compound Name | (3E,4E)-3-ethylidene-4-methylhepta-1,4-diene |
|---|---|
| PubChem CID | 143688525 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (3E,4E)-3-ethylidene-4-methylhepta-1,4-diene |
| SMILES | C=CC(=C\C)/C(C)=C/CC |
| InChI | InChI=1S/C10H16/c1-5-8-9(4)10(6-2)7-3/h6-8H,2,5H2,1,3-4H3/b9-8+,10-7+ |
| InChIKey | GJDPPTPNVMPTEE-DGLUDJRXSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|