C9H12ClF — CID 134389909
(3Z,5Z)-3-chloro-4-fluoro-5-methylocta-1,3,5-triene (PubChem CID 134389909) has the molecular formula C9H12ClF and a molecular weight of 174.65 g/mol. Its IUPAC name is (3Z,5Z)-3-chloro-4-fluoro-5-methylocta-1,3,5-triene.
| Compound Name | (3Z,5Z)-3-chloro-4-fluoro-5-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 134389909 |
| Molecular Formula | C9H12ClF |
| Molecular Weight | 174.65 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (3Z,5Z)-3-chloro-4-fluoro-5-methylocta-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(F)\C(C)=C/CC |
| InChI | InChI=1S/C9H12ClF/c1-4-6-7(3)9(11)8(10)5-2/h5-6H,2,4H2,1,3H3/b7-6-,9-8- |
| InChIKey | DBZORDAXJCEGTO-JPDBVBESSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|