About (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene
(3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene (PubChem CID 143348498) has the molecular formula C13H25Cl
and a molecular weight of 216.80 g/mol. Its IUPAC name is (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene.
Molecular Properties
| Compound Name | (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene |
| PubChem CID | 143348498 |
| Molecular Formula | C13H25Cl |
| Molecular Weight | 216.80 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene |
| SMILES | C=C.CC.CC/C=C(C)\C(Cl)=C/CC |
| InChI | InChI=1S/C9H15Cl.C2H6.C2H4/c1-4-6-8(3)9(10)7-5-2;2*1-2/h6-7H,4-5H2,1-3H3;1-2H3;1-2H2/b8-6-,9-7+;; |
| InChIKey | BQOIGFNULUUNEY-UYYQRFHASA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.80 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene?
The IUPAC name of (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene (CID 143348498) is (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene.
What is the SMILES notation for (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene?
The canonical SMILES for (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene is C=C.CC.CC/C=C(C)\C(Cl)=C/CC.
What is the InChIKey of (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene?
The InChIKey is BQOIGFNULUUNEY-UYYQRFHASA-N. The full InChI is InChI=1S/C9H15Cl.C2H6.C2H4/c1-4-6-8(3)9(10)7-5-2;2*1-2/h6-7H,4-5H2,1-3H3;1-2H3;1-2H2/b8-6-,9-7+;;.
What are the key properties of (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene?
(3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene has a molecular weight of 216.80 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-4-chloro-5-methylocta-3,5-diene;ethane;ethene is sourced from PubChem (CID 143348498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).