C9H17ClN2 — CID 123348699
N-ethyl-N,2-dimethylpent-2-enehydrazonoyl chloride (PubChem CID 123348699) has the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. Its IUPAC name is N-ethyl-N,2-dimethylpent-2-enehydrazonoyl chloride.
| Compound Name | N-ethyl-N,2-dimethylpent-2-enehydrazonoyl chloride |
|---|---|
| PubChem CID | 123348699 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N-ethyl-N,2-dimethylpent-2-enehydrazonoyl chloride |
| SMILES | CCC=C(C)C(Cl)=NN(C)CC |
| InChI | InChI=1S/C9H17ClN2/c1-5-7-8(3)9(10)11-12(4)6-2/h7H,5-6H2,1-4H3 |
| InChIKey | UDRCQGPPAPWPGL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|