C7H16ClN — CID 155386234
(E)-N,N-dimethylpent-2-en-2-amine;hydrochloride (PubChem CID 155386234) has the molecular formula C7H16ClN and a molecular weight of 149.66 g/mol. Its IUPAC name is (E)-N,N-dimethylpent-2-en-2-amine;hydrochloride.
| Compound Name | (E)-N,N-dimethylpent-2-en-2-amine;hydrochloride |
|---|---|
| PubChem CID | 155386234 |
| Molecular Formula | C7H16ClN |
| Molecular Weight | 149.66 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (E)-N,N-dimethylpent-2-en-2-amine;hydrochloride |
| SMILES | CC/C=C(\C)N(C)C.Cl |
| InChI | InChI=1S/C7H15N.ClH/c1-5-6-7(2)8(3)4;/h6H,5H2,1-4H3;1H/b7-6+; |
| InChIKey | DQMPTUJOYQPHIX-UHDJGPCESA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.66 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |