About methanamine;(Z)-pent-2-en-2-amine
methanamine;(Z)-pent-2-en-2-amine (PubChem CID 145487101) has the molecular formula C6H16N2
and a molecular weight of 116.21 g/mol. Its IUPAC name is methanamine;(Z)-pent-2-en-2-amine.
Molecular Properties
| Compound Name | methanamine;(Z)-pent-2-en-2-amine |
| PubChem CID | 145487101 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | methanamine;(Z)-pent-2-en-2-amine |
| SMILES | CC/C=C(/C)N.CN |
| InChI | InChI=1S/C5H11N.CH5N/c1-3-4-5(2)6;1-2/h4H,3,6H2,1-2H3;2H2,1H3/b5-4-; |
| InChIKey | RPFYSNZOLDVOGW-MKWAYWHRSA-N |
| XLogP | 0.83 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;(Z)-pent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;(Z)-pent-2-en-2-amine?
The IUPAC name of methanamine;(Z)-pent-2-en-2-amine (CID 145487101) is methanamine;(Z)-pent-2-en-2-amine.
What is the SMILES notation for methanamine;(Z)-pent-2-en-2-amine?
The canonical SMILES for methanamine;(Z)-pent-2-en-2-amine is CC/C=C(/C)N.CN.
What is the InChIKey of methanamine;(Z)-pent-2-en-2-amine?
The InChIKey is RPFYSNZOLDVOGW-MKWAYWHRSA-N. The full InChI is InChI=1S/C5H11N.CH5N/c1-3-4-5(2)6;1-2/h4H,3,6H2,1-2H3;2H2,1H3/b5-4-;.
What are the key properties of methanamine;(Z)-pent-2-en-2-amine?
methanamine;(Z)-pent-2-en-2-amine has a molecular weight of 116.21 g/mol, XLogP of 0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;(Z)-pent-2-en-2-amine is sourced from PubChem (CID 145487101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).