About (E)-oct-2-en-2-amine
(E)-oct-2-en-2-amine (PubChem CID 87259480) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is (E)-oct-2-en-2-amine.
Molecular Properties
| Compound Name | (E)-oct-2-en-2-amine |
| PubChem CID | 87259480 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (E)-oct-2-en-2-amine |
| SMILES | CCCCC/C=C(\C)N |
| InChI | InChI=1S/C8H17N/c1-3-4-5-6-7-8(2)9/h7H,3-6,9H2,1-2H3/b8-7+ |
| InChIKey | WDBLQASEPCWAAS-BQYQJAHWSA-N |
| XLogP | 2.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-oct-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-oct-2-en-2-amine?
The IUPAC name of (E)-oct-2-en-2-amine (CID 87259480) is (E)-oct-2-en-2-amine.
What is the SMILES notation for (E)-oct-2-en-2-amine?
The canonical SMILES for (E)-oct-2-en-2-amine is CCCCC/C=C(\C)N.
What is the InChIKey of (E)-oct-2-en-2-amine?
The InChIKey is WDBLQASEPCWAAS-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H17N/c1-3-4-5-6-7-8(2)9/h7H,3-6,9H2,1-2H3/b8-7+.
What are the key properties of (E)-oct-2-en-2-amine?
(E)-oct-2-en-2-amine has a molecular weight of 127.23 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-oct-2-en-2-amine is sourced from PubChem (CID 87259480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).