About (E)-octadec-9-en-9-amine
(E)-octadec-9-en-9-amine (PubChem CID 146566069) has the molecular formula C18H37N
and a molecular weight of 267.50 g/mol. Its IUPAC name is (E)-octadec-9-en-9-amine.
Molecular Properties
| Compound Name | (E)-octadec-9-en-9-amine |
| PubChem CID | 146566069 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | (E)-octadec-9-en-9-amine |
| SMILES | CCCCCCCC/C=C(/N)CCCCCCCC |
| InChI | InChI=1S/C18H37N/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h17H,3-16,19H2,1-2H3/b18-17+ |
| InChIKey | GKBHXYZWVWVCNZ-ISLYRVAYSA-N |
| XLogP | 6.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-octadec-9-en-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-octadec-9-en-9-amine?
The IUPAC name of (E)-octadec-9-en-9-amine (CID 146566069) is (E)-octadec-9-en-9-amine.
What is the SMILES notation for (E)-octadec-9-en-9-amine?
The canonical SMILES for (E)-octadec-9-en-9-amine is CCCCCCCC/C=C(/N)CCCCCCCC.
What is the InChIKey of (E)-octadec-9-en-9-amine?
The InChIKey is GKBHXYZWVWVCNZ-ISLYRVAYSA-N. The full InChI is InChI=1S/C18H37N/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h17H,3-16,19H2,1-2H3/b18-17+.
What are the key properties of (E)-octadec-9-en-9-amine?
(E)-octadec-9-en-9-amine has a molecular weight of 267.50 g/mol, XLogP of 6.33, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-octadec-9-en-9-amine is sourced from PubChem (CID 146566069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).