About (E)-dec-1-ene-1,2-diamine
(E)-dec-1-ene-1,2-diamine (PubChem CID 87327630) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is (E)-dec-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-dec-1-ene-1,2-diamine |
| PubChem CID | 87327630 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (E)-dec-1-ene-1,2-diamine |
| SMILES | CCCCCCCC/C(N)=C\N |
| InChI | InChI=1S/C10H22N2/c1-2-3-4-5-6-7-8-10(12)9-11/h9H,2-8,11-12H2,1H3/b10-9+ |
| InChIKey | WVBRSJVYTAPLEX-MDZDMXLPSA-N |
| XLogP | 2.50 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-dec-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-dec-1-ene-1,2-diamine?
The IUPAC name of (E)-dec-1-ene-1,2-diamine (CID 87327630) is (E)-dec-1-ene-1,2-diamine.
What is the SMILES notation for (E)-dec-1-ene-1,2-diamine?
The canonical SMILES for (E)-dec-1-ene-1,2-diamine is CCCCCCCC/C(N)=C\N.
What is the InChIKey of (E)-dec-1-ene-1,2-diamine?
The InChIKey is WVBRSJVYTAPLEX-MDZDMXLPSA-N. The full InChI is InChI=1S/C10H22N2/c1-2-3-4-5-6-7-8-10(12)9-11/h9H,2-8,11-12H2,1H3/b10-9+.
What are the key properties of (E)-dec-1-ene-1,2-diamine?
(E)-dec-1-ene-1,2-diamine has a molecular weight of 170.30 g/mol, XLogP of 2.50, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-dec-1-ene-1,2-diamine is sourced from PubChem (CID 87327630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).