C16H35N3 — CID 175489585
hexadec-1-ene-1,1,2-triamine (PubChem CID 175489585) has the molecular formula C16H35N3 and a molecular weight of 269.48 g/mol. Its IUPAC name is hexadec-1-ene-1,1,2-triamine.
| Compound Name | hexadec-1-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 175489585 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | hexadec-1-ene-1,1,2-triamine |
| SMILES | CCCCCCCCCCCCCCC(N)=C(N)N |
| InChI | InChI=1S/C16H35N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h2-14,17-19H2,1H3 |
| InChIKey | DWVHATJMWODBLW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|