About (Z)-nonadec-2-en-3-amine
(Z)-nonadec-2-en-3-amine (PubChem CID 139654417) has the molecular formula C19H39N
and a molecular weight of 281.53 g/mol. Its IUPAC name is (Z)-nonadec-2-en-3-amine.
Molecular Properties
| Compound Name | (Z)-nonadec-2-en-3-amine |
| PubChem CID | 139654417 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | (Z)-nonadec-2-en-3-amine |
| SMILES | C/C=C(\N)CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C19H39N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)4-2/h4H,3,5-18,20H2,1-2H3/b19-4- |
| InChIKey | QCEUAHSGNQMHFA-PVOVUMCXSA-N |
| XLogP | 6.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-nonadec-2-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-nonadec-2-en-3-amine?
The IUPAC name of (Z)-nonadec-2-en-3-amine (CID 139654417) is (Z)-nonadec-2-en-3-amine.
What is the SMILES notation for (Z)-nonadec-2-en-3-amine?
The canonical SMILES for (Z)-nonadec-2-en-3-amine is C/C=C(\N)CCCCCCCCCCCCCCCC.
What is the InChIKey of (Z)-nonadec-2-en-3-amine?
The InChIKey is QCEUAHSGNQMHFA-PVOVUMCXSA-N. The full InChI is InChI=1S/C19H39N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)4-2/h4H,3,5-18,20H2,1-2H3/b19-4-.
What are the key properties of (Z)-nonadec-2-en-3-amine?
(Z)-nonadec-2-en-3-amine has a molecular weight of 281.53 g/mol, XLogP of 6.72, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-nonadec-2-en-3-amine is sourced from PubChem (CID 139654417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).