About tricos-1-ene-1,1-diamine
tricos-1-ene-1,1-diamine (PubChem CID 141373485) has the molecular formula C23H48N2
and a molecular weight of 352.65 g/mol. Its IUPAC name is tricos-1-ene-1,1-diamine.
Molecular Properties
| Compound Name | tricos-1-ene-1,1-diamine |
| PubChem CID | 141373485 |
| Molecular Formula | C23H48N2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.38 |
| IUPAC Name | tricos-1-ene-1,1-diamine |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC=C(N)N |
| InChI | InChI=1S/C23H48N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h22H,2-21,24-25H2,1H3 |
| InChIKey | BLRDVLRXCYHIIQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tricos-1-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricos-1-ene-1,1-diamine?
The IUPAC name of tricos-1-ene-1,1-diamine (CID 141373485) is tricos-1-ene-1,1-diamine.
What is the SMILES notation for tricos-1-ene-1,1-diamine?
The canonical SMILES for tricos-1-ene-1,1-diamine is CCCCCCCCCCCCCCCCCCCCCC=C(N)N.
What is the InChIKey of tricos-1-ene-1,1-diamine?
The InChIKey is BLRDVLRXCYHIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h22H,2-21,24-25H2,1H3.
What are the key properties of tricos-1-ene-1,1-diamine?
tricos-1-ene-1,1-diamine has a molecular weight of 352.65 g/mol, XLogP of 7.57, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricos-1-ene-1,1-diamine is sourced from PubChem (CID 141373485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).