About 1,1-dibromotridec-1-ene
1,1-dibromotridec-1-ene (PubChem CID 14681915) has the molecular formula C13H24Br2
and a molecular weight of 340.14 g/mol. Its IUPAC name is 1,1-dibromotridec-1-ene.
Molecular Properties
| Compound Name | 1,1-dibromotridec-1-ene |
| PubChem CID | 14681915 |
| Molecular Formula | C13H24Br2 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1,1-dibromotridec-1-ene |
| SMILES | CCCCCCCCCCCC=C(Br)Br |
| InChI | InChI=1S/C13H24Br2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h12H,2-11H2,1H3 |
| InChIKey | ZKISRYDIXZXCLW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibromotridec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromotridec-1-ene?
The IUPAC name of 1,1-dibromotridec-1-ene (CID 14681915) is 1,1-dibromotridec-1-ene.
What is the SMILES notation for 1,1-dibromotridec-1-ene?
The canonical SMILES for 1,1-dibromotridec-1-ene is CCCCCCCCCCCC=C(Br)Br.
What is the InChIKey of 1,1-dibromotridec-1-ene?
The InChIKey is ZKISRYDIXZXCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24Br2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h12H,2-11H2,1H3.
What are the key properties of 1,1-dibromotridec-1-ene?
1,1-dibromotridec-1-ene has a molecular weight of 340.14 g/mol, XLogP of 6.54, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromotridec-1-ene is sourced from PubChem (CID 14681915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).