About 1,2-dibromodec-2-ene
1,2-dibromodec-2-ene (PubChem CID 54083778) has the molecular formula C10H18Br2
and a molecular weight of 298.06 g/mol. Its IUPAC name is 1,2-dibromodec-2-ene.
Molecular Properties
| Compound Name | 1,2-dibromodec-2-ene |
| PubChem CID | 54083778 |
| Molecular Formula | C10H18Br2 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 1,2-dibromodec-2-ene |
| SMILES | CCCCCCCC=C(Br)CBr |
| InChI | InChI=1S/C10H18Br2/c1-2-3-4-5-6-7-8-10(12)9-11/h8H,2-7,9H2,1H3 |
| InChIKey | MOYUOFHYXNBZCY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibromodec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromodec-2-ene?
The IUPAC name of 1,2-dibromodec-2-ene (CID 54083778) is 1,2-dibromodec-2-ene.
What is the SMILES notation for 1,2-dibromodec-2-ene?
The canonical SMILES for 1,2-dibromodec-2-ene is CCCCCCCC=C(Br)CBr.
What is the InChIKey of 1,2-dibromodec-2-ene?
The InChIKey is MOYUOFHYXNBZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Br2/c1-2-3-4-5-6-7-8-10(12)9-11/h8H,2-7,9H2,1H3.
What are the key properties of 1,2-dibromodec-2-ene?
1,2-dibromodec-2-ene has a molecular weight of 298.06 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromodec-2-ene is sourced from PubChem (CID 54083778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).