C17H33IO — CID 101378954
(E,3R)-5-iodo-2-methylhexadec-5-en-3-ol (PubChem CID 101378954) has the molecular formula C17H33IO and a molecular weight of 380.35 g/mol. Its IUPAC name is (E,3R)-5-iodo-2-methylhexadec-5-en-3-ol.
| Compound Name | (E,3R)-5-iodo-2-methylhexadec-5-en-3-ol |
|---|---|
| PubChem CID | 101378954 |
| Molecular Formula | C17H33IO |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (E,3R)-5-iodo-2-methylhexadec-5-en-3-ol |
| SMILES | CCCCCCCCCC/C=C(/I)C[C@@H](O)C(C)C |
| InChI | InChI=1S/C17H33IO/c1-4-5-6-7-8-9-10-11-12-13-16(18)14-17(19)15(2)3/h13,15,17,19H,4-12,14H2,1-3H3/b16-13+/t17-/m1/s1 |
| InChIKey | YXRLWOKLJRCTDR-HJUDDPQBSA-N |
| XLogP | 6.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|