About 5-iodotridec-5-en-4-ol
5-iodotridec-5-en-4-ol (PubChem CID 141095237) has the molecular formula C13H25IO
and a molecular weight of 324.25 g/mol. Its IUPAC name is 5-iodotridec-5-en-4-ol.
Molecular Properties
| Compound Name | 5-iodotridec-5-en-4-ol |
| PubChem CID | 141095237 |
| Molecular Formula | C13H25IO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 5-iodotridec-5-en-4-ol |
| SMILES | CCCCCCCC=C(I)C(O)CCC |
| InChI | InChI=1S/C13H25IO/c1-3-5-6-7-8-9-11-12(14)13(15)10-4-2/h11,13,15H,3-10H2,1-2H3 |
| InChIKey | IDJNNOUVENOUDC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodotridec-5-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodotridec-5-en-4-ol?
The IUPAC name of 5-iodotridec-5-en-4-ol (CID 141095237) is 5-iodotridec-5-en-4-ol.
What is the SMILES notation for 5-iodotridec-5-en-4-ol?
The canonical SMILES for 5-iodotridec-5-en-4-ol is CCCCCCCC=C(I)C(O)CCC.
What is the InChIKey of 5-iodotridec-5-en-4-ol?
The InChIKey is IDJNNOUVENOUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25IO/c1-3-5-6-7-8-9-11-12(14)13(15)10-4-2/h11,13,15H,3-10H2,1-2H3.
What are the key properties of 5-iodotridec-5-en-4-ol?
5-iodotridec-5-en-4-ol has a molecular weight of 324.25 g/mol, XLogP of 4.83, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodotridec-5-en-4-ol is sourced from PubChem (CID 141095237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).