About 1-ethoxy-1-iodooct-1-ene
1-ethoxy-1-iodooct-1-ene (PubChem CID 173444253) has the molecular formula C10H19IO
and a molecular weight of 282.16 g/mol. Its IUPAC name is 1-ethoxy-1-iodooct-1-ene.
Molecular Properties
| Compound Name | 1-ethoxy-1-iodooct-1-ene |
| PubChem CID | 173444253 |
| Molecular Formula | C10H19IO |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-ethoxy-1-iodooct-1-ene |
| SMILES | CCCCCCC=C(I)OCC |
| InChI | InChI=1S/C10H19IO/c1-3-5-6-7-8-9-10(11)12-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | XZEBXLYPBVIGDW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-1-iodooct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-1-iodooct-1-ene?
The IUPAC name of 1-ethoxy-1-iodooct-1-ene (CID 173444253) is 1-ethoxy-1-iodooct-1-ene.
What is the SMILES notation for 1-ethoxy-1-iodooct-1-ene?
The canonical SMILES for 1-ethoxy-1-iodooct-1-ene is CCCCCCC=C(I)OCC.
What is the InChIKey of 1-ethoxy-1-iodooct-1-ene?
The InChIKey is XZEBXLYPBVIGDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19IO/c1-3-5-6-7-8-9-10(11)12-4-2/h9H,3-8H2,1-2H3.
What are the key properties of 1-ethoxy-1-iodooct-1-ene?
1-ethoxy-1-iodooct-1-ene has a molecular weight of 282.16 g/mol, XLogP of 4.27, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-1-iodooct-1-ene is sourced from PubChem (CID 173444253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).