About 3-propyldodec-3-en-2-ol
3-propyldodec-3-en-2-ol (PubChem CID 71375191) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is 3-propyldodec-3-en-2-ol.
Molecular Properties
| Compound Name | 3-propyldodec-3-en-2-ol |
| PubChem CID | 71375191 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 3-propyldodec-3-en-2-ol |
| SMILES | CCCCCCCCC=C(CCC)C(C)O |
| InChI | InChI=1S/C15H30O/c1-4-6-7-8-9-10-11-13-15(12-5-2)14(3)16/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | ZVKMYDBEENIYOP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-propyldodec-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyldodec-3-en-2-ol?
The IUPAC name of 3-propyldodec-3-en-2-ol (CID 71375191) is 3-propyldodec-3-en-2-ol.
What is the SMILES notation for 3-propyldodec-3-en-2-ol?
The canonical SMILES for 3-propyldodec-3-en-2-ol is CCCCCCCCC=C(CCC)C(C)O.
What is the InChIKey of 3-propyldodec-3-en-2-ol?
The InChIKey is ZVKMYDBEENIYOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-4-6-7-8-9-10-11-13-15(12-5-2)14(3)16/h13-14,16H,4-12H2,1-3H3.
What are the key properties of 3-propyldodec-3-en-2-ol?
3-propyldodec-3-en-2-ol has a molecular weight of 226.40 g/mol, XLogP of 4.84, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyldodec-3-en-2-ol is sourced from PubChem (CID 71375191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).