About (Z)-tetradec-5-en-5-ol
(Z)-tetradec-5-en-5-ol (PubChem CID 129379563) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is (Z)-tetradec-5-en-5-ol.
Molecular Properties
| Compound Name | (Z)-tetradec-5-en-5-ol |
| PubChem CID | 129379563 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (Z)-tetradec-5-en-5-ol |
| SMILES | CCCCCCCC/C=C(\O)CCCC |
| InChI | InChI=1S/C14H28O/c1-3-5-7-8-9-10-11-13-14(15)12-6-4-2/h13,15H,3-12H2,1-2H3/b14-13- |
| InChIKey | FMYDPGOHVVAIGP-YPKPFQOOSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-tetradec-5-en-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-tetradec-5-en-5-ol?
The IUPAC name of (Z)-tetradec-5-en-5-ol (CID 129379563) is (Z)-tetradec-5-en-5-ol.
What is the SMILES notation for (Z)-tetradec-5-en-5-ol?
The canonical SMILES for (Z)-tetradec-5-en-5-ol is CCCCCCCC/C=C(\O)CCCC.
What is the InChIKey of (Z)-tetradec-5-en-5-ol?
The InChIKey is FMYDPGOHVVAIGP-YPKPFQOOSA-N. The full InChI is InChI=1S/C14H28O/c1-3-5-7-8-9-10-11-13-14(15)12-6-4-2/h13,15H,3-12H2,1-2H3/b14-13-.
What are the key properties of (Z)-tetradec-5-en-5-ol?
(Z)-tetradec-5-en-5-ol has a molecular weight of 212.38 g/mol, XLogP of 5.37, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-tetradec-5-en-5-ol is sourced from PubChem (CID 129379563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).