About 3-hydroxydec-3-enal
3-hydroxydec-3-enal (PubChem CID 174452166) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-hydroxydec-3-enal.
Molecular Properties
| Compound Name | 3-hydroxydec-3-enal |
| PubChem CID | 174452166 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3-hydroxydec-3-enal |
| SMILES | CCCCCCC=C(O)CC=O |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-10(12)8-9-11/h7,9,12H,2-6,8H2,1H3 |
| InChIKey | QVGUQCUSBBUQND-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxydec-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxydec-3-enal?
The IUPAC name of 3-hydroxydec-3-enal (CID 174452166) is 3-hydroxydec-3-enal.
What is the SMILES notation for 3-hydroxydec-3-enal?
The canonical SMILES for 3-hydroxydec-3-enal is CCCCCCC=C(O)CC=O.
What is the InChIKey of 3-hydroxydec-3-enal?
The InChIKey is QVGUQCUSBBUQND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-2-3-4-5-6-7-10(12)8-9-11/h7,9,12H,2-6,8H2,1H3.
What are the key properties of 3-hydroxydec-3-enal?
3-hydroxydec-3-enal has a molecular weight of 170.25 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxydec-3-enal is sourced from PubChem (CID 174452166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).