C15H28O — CID 101365454
(3E)-3-hexylnona-3,8-dien-2-ol (PubChem CID 101365454) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (3E)-3-hexylnona-3,8-dien-2-ol.
| Compound Name | (3E)-3-hexylnona-3,8-dien-2-ol |
|---|---|
| PubChem CID | 101365454 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (3E)-3-hexylnona-3,8-dien-2-ol |
| SMILES | C=CCCC/C=C(\CCCCCC)C(C)O |
| InChI | InChI=1S/C15H28O/c1-4-6-8-10-12-15(14(3)16)13-11-9-7-5-2/h4,12,14,16H,1,5-11,13H2,2-3H3/b15-12+ |
| InChIKey | CHBVAYMUSBHNTA-NTCAYCPXSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|