C8H19N2NaO3S — CID 86751100
sodium;hydrogen sulfite;oct-1-ene-1,1-diamine (PubChem CID 86751100) has the molecular formula C8H19N2NaO3S and a molecular weight of 246.31 g/mol. Its IUPAC name is sodium;hydrogen sulfite;oct-1-ene-1,1-diamine.
| Compound Name | sodium;hydrogen sulfite;oct-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 86751100 |
| Molecular Formula | C8H19N2NaO3S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | sodium;hydrogen sulfite;oct-1-ene-1,1-diamine |
| SMILES | CCCCCCC=C(N)N.O=S([O-])O.[Na+] |
| InChI | InChI=1S/C8H18N2.Na.H2O3S/c1-2-3-4-5-6-7-8(9)10;;1-4(2)3/h7H,2-6,9-10H2,1H3;;(H2,1,2,3)/q;+1;/p-1 |
| InChIKey | PSLLFMGOTMYIOR-UHFFFAOYSA-M |
| XLogP | -1.94 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|