About lithium;octane;sulfite
lithium;octane;sulfite (PubChem CID 122668940) has the molecular formula C8H18LiO3S-
and a molecular weight of 201.24 g/mol. Its IUPAC name is lithium;octane;sulfite.
Molecular Properties
| Compound Name | lithium;octane;sulfite |
| PubChem CID | 122668940 |
| Molecular Formula | C8H18LiO3S- |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | lithium;octane;sulfite |
| SMILES | CCCCCCCC.O=S([O-])[O-].[Li+] |
| InChI | InChI=1S/C8H18.Li.H2O3S/c1-3-5-7-8-6-4-2;;1-4(2)3/h3-8H2,1-2H3;;(H2,1,2,3)/q;+1;/p-2 |
| InChIKey | HJHLCMASMHDBJX-UHFFFAOYSA-L |
| XLogP | -0.63 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze lithium;octane;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;octane;sulfite?
The IUPAC name of lithium;octane;sulfite (CID 122668940) is lithium;octane;sulfite.
What is the SMILES notation for lithium;octane;sulfite?
The canonical SMILES for lithium;octane;sulfite is CCCCCCCC.O=S([O-])[O-].[Li+].
What is the InChIKey of lithium;octane;sulfite?
The InChIKey is HJHLCMASMHDBJX-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H18.Li.H2O3S/c1-3-5-7-8-6-4-2;;1-4(2)3/h3-8H2,1-2H3;;(H2,1,2,3)/q;+1;/p-2.
What are the key properties of lithium;octane;sulfite?
lithium;octane;sulfite has a molecular weight of 201.24 g/mol, XLogP of -0.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;octane;sulfite is sourced from PubChem (CID 122668940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).