About silver dodecane-1-sulfinate
silver dodecane-1-sulfinate (PubChem CID 86740193) has the molecular formula C12H25AgO2S
and a molecular weight of 341.27 g/mol. Its IUPAC name is silver dodecane-1-sulfinate.
Molecular Properties
| Compound Name | silver dodecane-1-sulfinate |
| PubChem CID | 86740193 |
| Molecular Formula | C12H25AgO2S |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | silver dodecane-1-sulfinate |
| SMILES | CCCCCCCCCCCCS(=O)[O-].[Ag+] |
| InChI | InChI=1S/C12H26O2S.Ag/c1-2-3-4-5-6-7-8-9-10-11-12-15(13)14;/h2-12H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | HGFBSQYAAUYYFQ-UHFFFAOYSA-M |
| XLogP | 3.78 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze silver dodecane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver dodecane-1-sulfinate?
The IUPAC name of silver dodecane-1-sulfinate (CID 86740193) is silver dodecane-1-sulfinate.
What is the SMILES notation for silver dodecane-1-sulfinate?
The canonical SMILES for silver dodecane-1-sulfinate is CCCCCCCCCCCCS(=O)[O-].[Ag+].
What is the InChIKey of silver dodecane-1-sulfinate?
The InChIKey is HGFBSQYAAUYYFQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H26O2S.Ag/c1-2-3-4-5-6-7-8-9-10-11-12-15(13)14;/h2-12H2,1H3,(H,13,14);/q;+1/p-1.
What are the key properties of silver dodecane-1-sulfinate?
silver dodecane-1-sulfinate has a molecular weight of 341.27 g/mol, XLogP of 3.78, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver dodecane-1-sulfinate is sourced from PubChem (CID 86740193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).