About 1-methylsulfinylicosane
1-methylsulfinylicosane (PubChem CID 53482744) has the molecular formula C21H44OS
and a molecular weight of 344.65 g/mol. Its IUPAC name is 1-methylsulfinylicosane.
Molecular Properties
| Compound Name | 1-methylsulfinylicosane |
| PubChem CID | 53482744 |
| Molecular Formula | C21H44OS |
| Molecular Weight | 344.65 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | 1-methylsulfinylicosane |
| SMILES | CCCCCCCCCCCCCCCCCCCCS(C)=O |
| InChI | InChI=1S/C21H44OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(2)22/h3-21H2,1-2H3 |
| InChIKey | IITORNXCQDCOPN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.65 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methylsulfinylicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfinylicosane?
The IUPAC name of 1-methylsulfinylicosane (CID 53482744) is 1-methylsulfinylicosane.
What is the SMILES notation for 1-methylsulfinylicosane?
The canonical SMILES for 1-methylsulfinylicosane is CCCCCCCCCCCCCCCCCCCCS(C)=O.
What is the InChIKey of 1-methylsulfinylicosane?
The InChIKey is IITORNXCQDCOPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(2)22/h3-21H2,1-2H3.
What are the key properties of 1-methylsulfinylicosane?
1-methylsulfinylicosane has a molecular weight of 344.65 g/mol, XLogP of 7.41, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfinylicosane is sourced from PubChem (CID 53482744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).