About sodium;hexane-1-sulfinic acid;hydride
sodium;hexane-1-sulfinic acid;hydride (PubChem CID 173414906) has the molecular formula C6H15NaO2S
and a molecular weight of 174.24 g/mol. Its IUPAC name is sodium;hexane-1-sulfinic acid;hydride.
Molecular Properties
| Compound Name | sodium;hexane-1-sulfinic acid;hydride |
| PubChem CID | 173414906 |
| Molecular Formula | C6H15NaO2S |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | sodium;hexane-1-sulfinic acid;hydride |
| SMILES | CCCCCCS(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C6H14O2S.Na.H/c1-2-3-4-5-6-9(7)8;;/h2-6H2,1H3,(H,7,8);;/q;+1;-1 |
| InChIKey | BEUHMOSTFFRWRM-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hexane-1-sulfinic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hexane-1-sulfinic acid;hydride?
The IUPAC name of sodium;hexane-1-sulfinic acid;hydride (CID 173414906) is sodium;hexane-1-sulfinic acid;hydride.
What is the SMILES notation for sodium;hexane-1-sulfinic acid;hydride?
The canonical SMILES for sodium;hexane-1-sulfinic acid;hydride is CCCCCCS(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hexane-1-sulfinic acid;hydride?
The InChIKey is BEUHMOSTFFRWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2S.Na.H/c1-2-3-4-5-6-9(7)8;;/h2-6H2,1H3,(H,7,8);;/q;+1;-1.
What are the key properties of sodium;hexane-1-sulfinic acid;hydride?
sodium;hexane-1-sulfinic acid;hydride has a molecular weight of 174.24 g/mol, XLogP of -1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hexane-1-sulfinic acid;hydride is sourced from PubChem (CID 173414906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).