About pentadecane-1-sulfinic acid
pentadecane-1-sulfinic acid (PubChem CID 20739365) has the molecular formula C15H32O2S
and a molecular weight of 276.49 g/mol. Its IUPAC name is pentadecane-1-sulfinic acid.
Molecular Properties
| Compound Name | pentadecane-1-sulfinic acid |
| PubChem CID | 20739365 |
| Molecular Formula | C15H32O2S |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | pentadecane-1-sulfinic acid |
| SMILES | CCCCCCCCCCCCCCCS(=O)O |
| InChI | InChI=1S/C15H32O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(16)17/h2-15H2,1H3,(H,16,17) |
| InChIKey | VLMMUHXPYVPIEZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze pentadecane-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecane-1-sulfinic acid?
The IUPAC name of pentadecane-1-sulfinic acid (CID 20739365) is pentadecane-1-sulfinic acid.
What is the SMILES notation for pentadecane-1-sulfinic acid?
The canonical SMILES for pentadecane-1-sulfinic acid is CCCCCCCCCCCCCCCS(=O)O.
What is the InChIKey of pentadecane-1-sulfinic acid?
The InChIKey is VLMMUHXPYVPIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(16)17/h2-15H2,1H3,(H,16,17).
What are the key properties of pentadecane-1-sulfinic acid?
pentadecane-1-sulfinic acid has a molecular weight of 276.49 g/mol, XLogP of 5.30, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecane-1-sulfinic acid is sourced from PubChem (CID 20739365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).