About 1-ethylsulfinyloctane
1-ethylsulfinyloctane (PubChem CID 54141160) has the molecular formula C10H22OS
and a molecular weight of 190.35 g/mol. Its IUPAC name is 1-ethylsulfinyloctane.
Molecular Properties
| Compound Name | 1-ethylsulfinyloctane |
| PubChem CID | 54141160 |
| Molecular Formula | C10H22OS |
| Molecular Weight | 190.35 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-ethylsulfinyloctane |
| SMILES | CCCCCCCCS(=O)CC |
| InChI | InChI=1S/C10H22OS/c1-3-5-6-7-8-9-10-12(11)4-2/h3-10H2,1-2H3 |
| InChIKey | OBEZKSPNIWCNFE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylsulfinyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfinyloctane?
The IUPAC name of 1-ethylsulfinyloctane (CID 54141160) is 1-ethylsulfinyloctane.
What is the SMILES notation for 1-ethylsulfinyloctane?
The canonical SMILES for 1-ethylsulfinyloctane is CCCCCCCCS(=O)CC.
What is the InChIKey of 1-ethylsulfinyloctane?
The InChIKey is OBEZKSPNIWCNFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22OS/c1-3-5-6-7-8-9-10-12(11)4-2/h3-10H2,1-2H3.
What are the key properties of 1-ethylsulfinyloctane?
1-ethylsulfinyloctane has a molecular weight of 190.35 g/mol, XLogP of 3.12, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfinyloctane is sourced from PubChem (CID 54141160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).