About lithium octadecane-1-sulfinate
lithium octadecane-1-sulfinate (PubChem CID 23714371) has the molecular formula C18H37LiO2S
and a molecular weight of 324.50 g/mol. Its IUPAC name is lithium octadecane-1-sulfinate.
Molecular Properties
| Compound Name | lithium octadecane-1-sulfinate |
| PubChem CID | 23714371 |
| Molecular Formula | C18H37LiO2S |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | lithium octadecane-1-sulfinate |
| SMILES | CCCCCCCCCCCCCCCCCCS(=O)[O-].[Li+] |
| InChI | InChI=1S/C18H38O2S.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(19)20;/h2-18H2,1H3,(H,19,20);/q;+1/p-1 |
| InChIKey | QPZGMSLQQTWRQU-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze lithium octadecane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium octadecane-1-sulfinate?
The IUPAC name of lithium octadecane-1-sulfinate (CID 23714371) is lithium octadecane-1-sulfinate.
What is the SMILES notation for lithium octadecane-1-sulfinate?
The canonical SMILES for lithium octadecane-1-sulfinate is CCCCCCCCCCCCCCCCCCS(=O)[O-].[Li+].
What is the InChIKey of lithium octadecane-1-sulfinate?
The InChIKey is QPZGMSLQQTWRQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H38O2S.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(19)20;/h2-18H2,1H3,(H,19,20);/q;+1/p-1.
What are the key properties of lithium octadecane-1-sulfinate?
lithium octadecane-1-sulfinate has a molecular weight of 324.50 g/mol, XLogP of 3.13, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium octadecane-1-sulfinate is sourced from PubChem (CID 23714371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).