C7H15N — CID 146859099
(E,2R)-3-methylhex-3-en-2-amine (PubChem CID 146859099) has the molecular formula C7H15N and a molecular weight of 113.20 g/mol. Its IUPAC name is (E,2R)-3-methylhex-3-en-2-amine.
| Compound Name | (E,2R)-3-methylhex-3-en-2-amine |
|---|---|
| PubChem CID | 146859099 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | (E,2R)-3-methylhex-3-en-2-amine |
| SMILES | CC/C=C(\C)[C@@H](C)N |
| InChI | InChI=1S/C7H15N/c1-4-5-6(2)7(3)8/h5,7H,4,8H2,1-3H3/b6-5+/t7-/m1/s1 |
| InChIKey | SKERAKLIBNCSEP-WEWAHIQMSA-N |
| XLogP | 1.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|