C8H14O — CID 88870284
(E,2R)-2,3-dimethylhex-3-enal (PubChem CID 88870284) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (E,2R)-2,3-dimethylhex-3-enal.
| Compound Name | (E,2R)-2,3-dimethylhex-3-enal |
|---|---|
| PubChem CID | 88870284 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (E,2R)-2,3-dimethylhex-3-enal |
| SMILES | CC/C=C(\C)[C@@H](C)C=O |
| InChI | InChI=1S/C8H14O/c1-4-5-7(2)8(3)6-9/h5-6,8H,4H2,1-3H3/b7-5+/t8-/m0/s1 |
| InChIKey | AJOSBZNTAZGQKB-IVGLGHLBSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|