C13H25NO — CID 155349088
(Z,2R)-4,5-dimethyl-3-[(Z)-pent-2-en-2-yl]oxyhex-3-en-2-amine (PubChem CID 155349088) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (Z,2R)-4,5-dimethyl-3-[(Z)-pent-2-en-2-yl]oxyhex-3-en-2-amine.
| Compound Name | (Z,2R)-4,5-dimethyl-3-[(Z)-pent-2-en-2-yl]oxyhex-3-en-2-amine |
|---|---|
| PubChem CID | 155349088 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (Z,2R)-4,5-dimethyl-3-[(Z)-pent-2-en-2-yl]oxyhex-3-en-2-amine |
| SMILES | CC/C=C(/C)O/C(=C(/C)C(C)C)[C@@H](C)N |
| InChI | InChI=1S/C13H25NO/c1-7-8-10(4)15-13(12(6)14)11(5)9(2)3/h8-9,12H,7,14H2,1-6H3/b10-8-,13-11-/t12-/m1/s1 |
| InChIKey | XRRGZAQQNMLFGC-FFYHPTDTSA-N |
| XLogP | 3.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|