C14H31NO — CID 142810190
ethane;2-methylpropane;(Z)-2-prop-1-en-2-yloxypent-2-en-1-amine (PubChem CID 142810190) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is ethane;2-methylpropane;(Z)-2-prop-1-en-2-yloxypent-2-en-1-amine.
| Compound Name | ethane;2-methylpropane;(Z)-2-prop-1-en-2-yloxypent-2-en-1-amine |
|---|---|
| PubChem CID | 142810190 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | ethane;2-methylpropane;(Z)-2-prop-1-en-2-yloxypent-2-en-1-amine |
| SMILES | C=C(C)O/C(=C\CC)CN.CC.CC(C)C |
| InChI | InChI=1S/C8H15NO.C4H10.C2H6/c1-4-5-8(6-9)10-7(2)3;1-4(2)3;1-2/h5H,2,4,6,9H2,1,3H3;4H,1-3H3;1-2H3/b8-5-;; |
| InChIKey | FCIYAFLMUCMIEA-XTKZWJJBSA-N |
| XLogP | 4.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|