C13H29NO — CID 142180785
(Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine;2-methylpropane (PubChem CID 142180785) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine;2-methylpropane.
| Compound Name | (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine;2-methylpropane |
|---|---|
| PubChem CID | 142180785 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | (Z)-2-methoxy-4,5-dimethylhex-2-en-1-amine;2-methylpropane |
| SMILES | CC(C)C.CO/C(=C\C(C)C(C)C)CN |
| InChI | InChI=1S/C9H19NO.C4H10/c1-7(2)8(3)5-9(6-10)11-4;1-4(2)3/h5,7-8H,6,10H2,1-4H3;4H,1-3H3/b9-5-; |
| InChIKey | SSIVVYMYGMEGJF-UYTGOYFPSA-N |
| XLogP | 3.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|