About ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine
ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine (PubChem CID 142810077) has the molecular formula C13H32FNO
and a molecular weight of 237.40 g/mol. Its IUPAC name is ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine.
Molecular Properties
| Compound Name | ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine |
| PubChem CID | 142810077 |
| Molecular Formula | C13H32FNO |
| Molecular Weight | 237.40 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine |
| SMILES | CC.CC.CCF.CO/C(=C\C(C)C)CN |
| InChI | InChI=1S/C7H15NO.C2H5F.2C2H6/c1-6(2)4-7(5-8)9-3;1-2-3;2*1-2/h4,6H,5,8H2,1-3H3;2H2,1H3;2*1-2H3/b7-4-;;; |
| InChIKey | LBEIGXJZTUTMJT-LSQFMHCWSA-N |
| XLogP | 4.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine?
The IUPAC name of ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine (CID 142810077) is ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine.
What is the SMILES notation for ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine?
The canonical SMILES for ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine is CC.CC.CCF.CO/C(=C\C(C)C)CN.
What is the InChIKey of ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine?
The InChIKey is LBEIGXJZTUTMJT-LSQFMHCWSA-N. The full InChI is InChI=1S/C7H15NO.C2H5F.2C2H6/c1-6(2)4-7(5-8)9-3;1-2-3;2*1-2/h4,6H,5,8H2,1-3H3;2H2,1H3;2*1-2H3/b7-4-;;;.
What are the key properties of ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine?
ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine has a molecular weight of 237.40 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoroethane;(Z)-2-methoxy-4-methylpent-2-en-1-amine is sourced from PubChem (CID 142810077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).