About ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane
ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane (PubChem CID 142883613) has the molecular formula C11H26FNO
and a molecular weight of 207.33 g/mol. Its IUPAC name is ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane.
Molecular Properties
| Compound Name | ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane |
| PubChem CID | 142883613 |
| Molecular Formula | C11H26FNO |
| Molecular Weight | 207.33 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane |
| SMILES | CC.CC/C=C(/CN)OCC.CCF |
| InChI | InChI=1S/C7H15NO.C2H5F.C2H6/c1-3-5-7(6-8)9-4-2;1-2-3;1-2/h5H,3-4,6,8H2,1-2H3;2H2,1H3;1-2H3/b7-5-;; |
| InChIKey | KCGQBRFJZSJFSV-MWKZNRQPSA-N |
| XLogP | 3.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane?
The IUPAC name of ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane (CID 142883613) is ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane.
What is the SMILES notation for ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane?
The canonical SMILES for ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane is CC.CC/C=C(/CN)OCC.CCF.
What is the InChIKey of ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane?
The InChIKey is KCGQBRFJZSJFSV-MWKZNRQPSA-N. The full InChI is InChI=1S/C7H15NO.C2H5F.C2H6/c1-3-5-7(6-8)9-4-2;1-2-3;1-2/h5H,3-4,6,8H2,1-2H3;2H2,1H3;1-2H3/b7-5-;;.
What are the key properties of ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane?
ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane has a molecular weight of 207.33 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-2-ethoxypent-2-en-1-amine;fluoroethane is sourced from PubChem (CID 142883613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).