C10H17F2NO — CID 143077023
(5Z)-5-ethoxy-3,3-difluoroocta-1,5-dien-4-amine (PubChem CID 143077023) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is (5Z)-5-ethoxy-3,3-difluoroocta-1,5-dien-4-amine.
| Compound Name | (5Z)-5-ethoxy-3,3-difluoroocta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 143077023 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (5Z)-5-ethoxy-3,3-difluoroocta-1,5-dien-4-amine |
| SMILES | C=CC(F)(F)C(N)/C(=C/CC)OCC |
| InChI | InChI=1S/C10H17F2NO/c1-4-7-8(14-6-3)9(13)10(11,12)5-2/h5,7,9H,2,4,6,13H2,1,3H3/b8-7- |
| InChIKey | VWYRRQNNWJAXSI-FPLPWBNLSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|