C13H23F2NO — CID 142883593
ethane;(Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine (PubChem CID 142883593) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is ethane;(Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine.
| Compound Name | ethane;(Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine |
|---|---|
| PubChem CID | 142883593 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | ethane;(Z)-5-ethoxy-3,3-difluoronon-5-en-8-yn-4-amine |
| SMILES | C#CC/C=C(\OCC)C(N)C(F)(F)CC.CC |
| InChI | InChI=1S/C11H17F2NO.C2H6/c1-4-7-8-9(15-6-3)10(14)11(12,13)5-2;1-2/h1,8,10H,5-7,14H2,2-3H3;1-2H3/b9-8-; |
| InChIKey | JFGABTQDASCPOL-UOQXYWCXSA-N |
| XLogP | 3.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|