C11H21F2NO — CID 142810444
ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine (PubChem CID 142810444) has the molecular formula C11H21F2NO and a molecular weight of 221.29 g/mol. Its IUPAC name is ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine.
| Compound Name | ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 142810444 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | ethane;(5Z)-5-ethoxy-3,3-difluorohepta-1,5-dien-4-amine |
| SMILES | C=CC(F)(F)C(N)/C(=C/C)OCC.CC |
| InChI | InChI=1S/C9H15F2NO.C2H6/c1-4-7(13-6-3)8(12)9(10,11)5-2;1-2/h4-5,8H,2,6,12H2,1,3H3;1-2H3/b7-4-; |
| InChIKey | UAQGTIKBMBGSPW-ZULQGGHCSA-N |
| XLogP | 3.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|