C10H18O2 — CID 141009141
3,4-diethoxyhexa-2,4-diene (PubChem CID 141009141) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3,4-diethoxyhexa-2,4-diene.
| Compound Name | 3,4-diethoxyhexa-2,4-diene |
|---|---|
| PubChem CID | 141009141 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3,4-diethoxyhexa-2,4-diene |
| SMILES | CC=C(OCC)C(=CC)OCC |
| InChI | InChI=1S/C10H18O2/c1-5-9(11-7-3)10(6-2)12-8-4/h5-6H,7-8H2,1-4H3 |
| InChIKey | UJRFEYZOUDPRER-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|