About diethoxymethanimine;hydrochloride
diethoxymethanimine;hydrochloride (PubChem CID 45074582) has the molecular formula C5H12ClNO2
and a molecular weight of 153.61 g/mol. Its IUPAC name is diethoxymethanimine;hydrochloride.
Molecular Properties
| Compound Name | diethoxymethanimine;hydrochloride |
| PubChem CID | 45074582 |
| Molecular Formula | C5H12ClNO2 |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | diethoxymethanimine;hydrochloride |
| SMILES | Cl.[H]N=C(OCC)OCC |
| InChI | InChI=1S/C5H11NO2.ClH/c1-3-7-5(6)8-4-2;/h6H,3-4H2,1-2H3;1H |
| InChIKey | TUZMCRZBWLOTIZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze diethoxymethanimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxymethanimine;hydrochloride?
The IUPAC name of diethoxymethanimine;hydrochloride (CID 45074582) is diethoxymethanimine;hydrochloride.
What is the SMILES notation for diethoxymethanimine;hydrochloride?
The canonical SMILES for diethoxymethanimine;hydrochloride is Cl.[H]N=C(OCC)OCC.
What is the InChIKey of diethoxymethanimine;hydrochloride?
The InChIKey is TUZMCRZBWLOTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.ClH/c1-3-7-5(6)8-4-2;/h6H,3-4H2,1-2H3;1H.
What are the key properties of diethoxymethanimine;hydrochloride?
diethoxymethanimine;hydrochloride has a molecular weight of 153.61 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxymethanimine;hydrochloride is sourced from PubChem (CID 45074582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).