About 2-ethoxybut-2-ene;silane
2-ethoxybut-2-ene;silane (PubChem CID 174428196) has the molecular formula C6H16OSi
and a molecular weight of 132.28 g/mol. Its IUPAC name is 2-ethoxybut-2-ene;silane.
Molecular Properties
| Compound Name | 2-ethoxybut-2-ene;silane |
| PubChem CID | 174428196 |
| Molecular Formula | C6H16OSi |
| Molecular Weight | 132.28 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | 2-ethoxybut-2-ene;silane |
| SMILES | CC=C(C)OCC.[SiH4] |
| InChI | InChI=1S/C6H12O.H4Si/c1-4-6(3)7-5-2;/h4H,5H2,1-3H3;1H4 |
| InChIKey | CAJQOBQTQIAFFL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxybut-2-ene;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybut-2-ene;silane?
The IUPAC name of 2-ethoxybut-2-ene;silane (CID 174428196) is 2-ethoxybut-2-ene;silane.
What is the SMILES notation for 2-ethoxybut-2-ene;silane?
The canonical SMILES for 2-ethoxybut-2-ene;silane is CC=C(C)OCC.[SiH4].
What is the InChIKey of 2-ethoxybut-2-ene;silane?
The InChIKey is CAJQOBQTQIAFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.H4Si/c1-4-6(3)7-5-2;/h4H,5H2,1-3H3;1H4.
What are the key properties of 2-ethoxybut-2-ene;silane?
2-ethoxybut-2-ene;silane has a molecular weight of 132.28 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybut-2-ene;silane is sourced from PubChem (CID 174428196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).