C7H14O2 — CID 56606177
(Z)-1,2-diethoxyprop-1-ene (PubChem CID 56606177) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (Z)-1,2-diethoxyprop-1-ene.
| Compound Name | (Z)-1,2-diethoxyprop-1-ene |
|---|---|
| PubChem CID | 56606177 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (Z)-1,2-diethoxyprop-1-ene |
| SMILES | CCO/C=C(/C)OCC |
| InChI | InChI=1S/C7H14O2/c1-4-8-6-7(3)9-5-2/h6H,4-5H2,1-3H3/b7-6- |
| InChIKey | UOUCPWAGGFHRQE-SREVYHEPSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|