C10H16O — CID 90777101
3-(ethoxymethylidene)-2,4-dimethylpenta-1,4-diene (PubChem CID 90777101) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-(ethoxymethylidene)-2,4-dimethylpenta-1,4-diene.
| Compound Name | 3-(ethoxymethylidene)-2,4-dimethylpenta-1,4-diene |
|---|---|
| PubChem CID | 90777101 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 3-(ethoxymethylidene)-2,4-dimethylpenta-1,4-diene |
| SMILES | C=C(C)C(=COCC)C(=C)C |
| InChI | InChI=1S/C10H16O/c1-6-11-7-10(8(2)3)9(4)5/h7H,2,4,6H2,1,3,5H3 |
| InChIKey | HDOGOPHKARKFFR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|