C12H20O3 — CID 166927824
5-(ethoxymethylidene)nonane-4,6-dione (PubChem CID 166927824) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-(ethoxymethylidene)nonane-4,6-dione.
| Compound Name | 5-(ethoxymethylidene)nonane-4,6-dione |
|---|---|
| PubChem CID | 166927824 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 5-(ethoxymethylidene)nonane-4,6-dione |
| SMILES | CCCC(=O)C(=COCC)C(=O)CCC |
| InChI | InChI=1S/C12H20O3/c1-4-7-11(13)10(9-15-6-3)12(14)8-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | RZFDTORMFOKBPN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|