C9H10F2O5 — CID 150868880
2-(ethoxymethylidene)-6,6-difluoro-3,5-dioxohexanoic acid (PubChem CID 150868880) has the molecular formula C9H10F2O5 and a molecular weight of 236.17 g/mol. Its IUPAC name is 2-(ethoxymethylidene)-6,6-difluoro-3,5-dioxohexanoic acid.
| Compound Name | 2-(ethoxymethylidene)-6,6-difluoro-3,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 150868880 |
| Molecular Formula | C9H10F2O5 |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-(ethoxymethylidene)-6,6-difluoro-3,5-dioxohexanoic acid |
| SMILES | CCOC=C(C(=O)O)C(=O)CC(=O)C(F)F |
| InChI | InChI=1S/C9H10F2O5/c1-2-16-4-5(9(14)15)6(12)3-7(13)8(10)11/h4,8H,2-3H2,1H3,(H,14,15) |
| InChIKey | KTPRWXCXOCCGET-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|