methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate

C10H16O3 — CID 135132678

IUPACmethyl 3-(ethoxymethylidene)-4-methylpent-4-enoate
SMILESC=C(C)C(=COCC)CC(=O)OC
InChIInChI=1S/C10H16O3/c1-5-13-7-9(8(2)3)6-10(11)12-4/h7H,2,5-6H2,1,3-4H3
InChIKeyNEKLAMWLIBYHSI-UHFFFAOYSA-N
MW184.23 g/mol
LogP2.05
Rot. Bonds5

About methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate

methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate (PubChem CID 135132678) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate.

Molecular Properties

Compound Namemethyl 3-(ethoxymethylidene)-4-methylpent-4-enoate
PubChem CID135132678
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Namemethyl 3-(ethoxymethylidene)-4-methylpent-4-enoate
SMILESC=C(C)C(=COCC)CC(=O)OC
InChIInChI=1S/C10H16O3/c1-5-13-7-9(8(2)3)6-10(11)12-4/h7H,2,5-6H2,1,3-4H3
InChIKeyNEKLAMWLIBYHSI-UHFFFAOYSA-N
XLogP2.05
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 52.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate?
The IUPAC name of methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate (CID 135132678) is methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate.
What is the SMILES notation for methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate?
The canonical SMILES for methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate is C=C(C)C(=COCC)CC(=O)OC.
What is the InChIKey of methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate?
The InChIKey is NEKLAMWLIBYHSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-5-13-7-9(8(2)3)6-10(11)12-4/h7H,2,5-6H2,1,3-4H3.
What are the key properties of methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate?
methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate has a molecular weight of 184.23 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(ethoxymethylidene)-4-methylpent-4-enoate is sourced from PubChem (CID 135132678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).