C8H11F3O2 — CID 11665576
(3E)-3-(ethoxymethylidene)-1,1,1-trifluoropentan-2-one (PubChem CID 11665576) has the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. Its IUPAC name is (3E)-3-(ethoxymethylidene)-1,1,1-trifluoropentan-2-one.
| Compound Name | (3E)-3-(ethoxymethylidene)-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 11665576 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3E)-3-(ethoxymethylidene)-1,1,1-trifluoropentan-2-one |
| SMILES | CCO/C=C(\CC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2/c1-3-6(5-13-4-2)7(12)8(9,10)11/h5H,3-4H2,1-2H3/b6-5+ |
| InChIKey | MVCUJRLOFOCVKS-AATRIKPKSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|